CAS 193274-00-9 appears in our catalog under these names: 1-tert-Butyl 3-methyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate, 95%, 1–tert–Butyl 3–methyl 3–benzyl–4–oxopiperidine–1,3–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-O-tert-butyl 3-O-methyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate (CAS 193274-00-9) is a chemical compound with the molecular formula C19H25NO5 and a molecular weight of 347.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate. InChIKey: RZVFNCJYXSLWPA-UHFFFAOYSA-N.
| Molecular formula | C19H25NO5 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate |
| InChIKey | RZVFNCJYXSLWPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)(CC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)