Products 59058-64-9
CAS 59058-64-9 appears in our catalog under these names: Mycophenolate Dimethylamide, Mycophenolate Impurity 6, Mycophenolate Dimethyalamide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N,N,4-trimethylhex-4-enamide (CAS 59058-64-9) is a chemical compound with the molecular formula C19H25NO5 and a molecular weight of 347.4 g/mol. IUPAC name: (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N,N,4-trimethylhex-4-enamide. InChIKey: JHEWUGRKJIGBJZ-IZZDOVSWSA-N.
| Molecular formula | C19H25NO5 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N,N,4-trimethylhex-4-enamide |
| InChIKey | JHEWUGRKJIGBJZ-IZZDOVSWSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)N(C)C)O |
Computed by PubChem (NCBI)