Products 2089652-17-3
CAS 2089652-17-3 is the registry number for tert-Butyl 3-((tert-butoxycarbonyloxy)methyl)-1h-indole-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]indole-1-carboxylate (CAS 2089652-17-3) is a chemical compound with the molecular formula C19H25NO5 and a molecular weight of 347.4 g/mol. IUPAC name: tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]indole-1-carboxylate. InChIKey: POQQDUFVMOTWIR-UHFFFAOYSA-N.
| Molecular formula | C19H25NO5 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]indole-1-carboxylate |
| InChIKey | POQQDUFVMOTWIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)COC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)