CAS 1932787-71-7 appears in our catalog under these names: (3S,5R)-1-[(tert-Butoxy)carbonyl]-5-methylpyrrolidine-3-carboxylic acid, 95%, (3S,5R)-1-(tert-Butoxycarbonyl)-5-methylpyrrolidine-3-carboxylic acid, 97%, 1,3-Pyrrolidinedicarboxylic acid, 5-methyl-, 1-(1,1-dimethylethyl) ester, (3S,5R)-, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(3S,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1932787-71-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3S,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: WZZGWPOKJCVJGU-SFYZADRCSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3S,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | WZZGWPOKJCVJGU-SFYZADRCSA-N |
| SMILES | C[C@@H]1C[C@@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)