CAS 2387562-37-8 is the registry number for (3R,5S)-1-(tert-Butoxycarbonyl)-5-methylpyrrolidine-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(3R,5S)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2387562-37-8) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3R,5S)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: WZZGWPOKJCVJGU-JGVFFNPUSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3R,5S)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | WZZGWPOKJCVJGU-JGVFFNPUSA-N |
| SMILES | C[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)