CAS 1933777-06-0 is the registry number for (1S,4S,6R)-7-(Trifluoromethyl)-2-oxa-5-azabicyclo[4.1.0]heptane-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4S,6R)-7-(trifluoromethyl)-2-oxa-5-azabicyclo[4.1.0]heptane-4-carboxylic acid (CAS 1933777-06-0) is a chemical compound with the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. IUPAC name: (1S,4S,6R)-7-(trifluoromethyl)-2-oxa-5-azabicyclo[4.1.0]heptane-4-carboxylic acid. InChIKey: VBJRFGQQIJIQLF-HMBKUUBJSA-N.
| Molecular formula | C7H8F3NO3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | (1S,4S,6R)-7-(trifluoromethyl)-2-oxa-5-azabicyclo[4.1.0]heptane-4-carboxylic acid |
| InChIKey | VBJRFGQQIJIQLF-HMBKUUBJSA-N |
| SMILES | C1[C@H](N[C@H]2[C@H](C2C(F)(F)F)O1)C(=O)O |
Computed by PubChem (NCBI)