CAS 1016823-41-8 is the registry number for 5-Oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid (CAS 1016823-41-8) is a chemical compound with the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. IUPAC name: 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid. InChIKey: PWWZFHSEJSRPFA-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid |
| InChIKey | PWWZFHSEJSRPFA-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)