Products 1016823-41-8

CAS 1016823-41-8 is the registry number for 5-Oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid (CAS 1016823-41-8) is a chemical compound with the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. IUPAC name: 5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid. InChIKey: PWWZFHSEJSRPFA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F3NO3
Molecular weight211.14 g/mol
IUPAC name5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxylic acid
InChIKeyPWWZFHSEJSRPFA-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)CC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)