Products 1408076-23-2
CAS 1408076-23-2 appears in our catalog under these names: 3-Ethynyl-3-hydroxyazetidine trifluoroacetate, 95%, 3-Ethynylazetidin-3-ol 2,2,2-trifluoroacetate, 98%, 3-Ethynylazetidin-3-ol TFA, 3-Ethynyl-3-hydroxyazetidine trifluoroacetate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g.
3-ethynylazetidin-3-ol;2,2,2-trifluoroacetic acid (CAS 1408076-23-2) is a chemical compound with the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. IUPAC name: 3-ethynylazetidin-3-ol;2,2,2-trifluoroacetic acid. InChIKey: PBJDPHQBGYPGRR-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 3-ethynylazetidin-3-ol;2,2,2-trifluoroacetic acid |
| InChIKey | PBJDPHQBGYPGRR-UHFFFAOYSA-N |
| SMILES | C#CC1(CNC1)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
3-Ethynylazetidin-3-ol trifluoroacetate, 3-Ethynyl-3-hydroxyazetidine trifluoroacetate, 3-ethynylazetidin-3-ol; trifluoroacetic acid, 3-ethynylazetidin-3-ol 2,2,2-trifluoroacetate, 3-ethynylazetidin-3-ol;2,2,2-trifluoroacetic acid, 3-Ethynylazetidin-3-ol TFA, 3-ethynylazetidin-3-ol trifluoroacetic acid