Products 1251057-15-4
CAS 1251057-15-4 appears in our catalog under these names: 1-((2,2,2-Trifluoroethyl)carbamoyl)cyclopropane-1-carboxylic acid, 95%, 95%, 1-((2,2,2-Trifluoroethyl)carbamoyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
1-(2,2,2-trifluoroethylcarbamoyl)cyclopropane-1-carboxylic acid (CAS 1251057-15-4) is a chemical compound with the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. IUPAC name: 1-(2,2,2-trifluoroethylcarbamoyl)cyclopropane-1-carboxylic acid. InChIKey: RBTTYJBOCHIEOK-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethylcarbamoyl)cyclopropane-1-carboxylic acid |
| InChIKey | RBTTYJBOCHIEOK-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)