CAS 1934402-19-3 appears in our catalog under these names: 1-Chloro-2-fluoro-5-methoxy-4-nitrobenzene, 95%, 1-Chloro-2-fluoro-5-methoxy-4-nitrobenzene, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-chloro-2-fluoro-5-methoxy-4-nitrobenzene (CAS 1934402-19-3) is a chemical compound with the molecular formula C7H5ClFNO3 and a molecular weight of 205.57 g/mol. IUPAC name: 1-chloro-2-fluoro-5-methoxy-4-nitrobenzene. InChIKey: BCBSYWPFWWVUAJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO3 |
|---|---|
| Molecular weight | 205.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-5-methoxy-4-nitrobenzene |
| InChIKey | BCBSYWPFWWVUAJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])F)Cl |
Computed by PubChem (NCBI)