Products 1934429-61-4
CAS 1934429-61-4 appears in our catalog under these names: 1-(4-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-ol, 97%, 97%, 1-(4-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-ol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
1-(4-bromo-2-pyridinyl)-2,2,2-trifluoroethanol (CAS 1934429-61-4) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 1-(4-bromo-2-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: VEGUZVBNTDRCTO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 1-(4-bromo-2-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | VEGUZVBNTDRCTO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)