CAS 1934445-70-1 appears in our catalog under these names: 3-Iodoquinoline-8-carboxylic acid, 95%, 3-Iodoquinoline-8-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-iodoquinoline-8-carboxylic acid (CAS 1934445-70-1) is a chemical compound with the molecular formula C10H6INO2 and a molecular weight of 299.06 g/mol. IUPAC name: 3-iodoquinoline-8-carboxylic acid. InChIKey: ALDCJZVVFAFTCW-UHFFFAOYSA-N.
| Molecular formula | C10H6INO2 |
|---|---|
| Molecular weight | 299.06 g/mol |
| IUPAC name | 3-iodoquinoline-8-carboxylic acid |
| InChIKey | ALDCJZVVFAFTCW-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)C(=O)O)I |
Computed by PubChem (NCBI)