CAS 65833-01-4 appears in our catalog under these names: 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione, 95+%, 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione 95+%, 1-(4-Iodophenyl)-1H-pyrrole-2,5-dione, 95+%, 95+%, 1-(4-Iodophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95+%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-(4-iodophenyl)pyrrole-2,5-dione (CAS 65833-01-4) is a chemical compound with the molecular formula C10H6INO2 and a molecular weight of 299.06 g/mol. IUPAC name: 1-(4-iodophenyl)pyrrole-2,5-dione. InChIKey: GIXQASIEVHMYQH-UHFFFAOYSA-N.
| Molecular formula | C10H6INO2 |
|---|---|
| Molecular weight | 299.06 g/mol |
| IUPAC name | 1-(4-iodophenyl)pyrrole-2,5-dione |
| InChIKey | GIXQASIEVHMYQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)I |
Computed by PubChem (NCBI)