CAS 2622236-07-9 is the registry number for 5-Hydroxy-6-iodo-1-oxo-2,3-dihydro-1H-indene-4-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-6-iodo-1-oxo-2,3-dihydroindene-4-carbonitrile (CAS 2622236-07-9) is a chemical compound with the molecular formula C10H6INO2 and a molecular weight of 299.06 g/mol. IUPAC name: 5-hydroxy-6-iodo-1-oxo-2,3-dihydroindene-4-carbonitrile. InChIKey: IKSICTCICFZSNZ-UHFFFAOYSA-N.
| Molecular formula | C10H6INO2 |
|---|---|
| Molecular weight | 299.06 g/mol |
| IUPAC name | 5-hydroxy-6-iodo-1-oxo-2,3-dihydroindene-4-carbonitrile |
| InChIKey | IKSICTCICFZSNZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C(=C21)C#N)O)I |
Computed by PubChem (NCBI)