CAS 1934495-33-6 is the registry number for tert-Butyl 3,3-difluoro-4-hydroxy-5,5-dimethylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3,3-difluoro-4-hydroxy-5,5-dimethylpiperidine-1-carboxylate (CAS 1934495-33-6) is a chemical compound with the molecular formula C12H21F2NO3 and a molecular weight of 265.30 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-hydroxy-5,5-dimethylpiperidine-1-carboxylate. InChIKey: BZKCUEMMSSBPIC-UHFFFAOYSA-N.
| Molecular formula | C12H21F2NO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-hydroxy-5,5-dimethylpiperidine-1-carboxylate |
| InChIKey | BZKCUEMMSSBPIC-UHFFFAOYSA-N |
| SMILES | CC1(CN(CC(C1O)(F)F)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)