Products 2348341-79-5
CAS 2348341-79-5 is the registry number for tert-butyl (R)-3-(1,1-difluoro-2-hydroxyethyl)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R)-3-(1,1-difluoro-2-hydroxyethyl)piperidine-1-carboxylate (CAS 2348341-79-5) is a chemical compound with the molecular formula C12H21F2NO3 and a molecular weight of 265.30 g/mol. IUPAC name: tert-butyl (3R)-3-(1,1-difluoro-2-hydroxyethyl)piperidine-1-carboxylate. InChIKey: TYVXQUSEQKKSGK-SECBINFHSA-N.
| Molecular formula | C12H21F2NO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(1,1-difluoro-2-hydroxyethyl)piperidine-1-carboxylate |
| InChIKey | TYVXQUSEQKKSGK-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(CO)(F)F |
Computed by PubChem (NCBI)