Products 2920407-92-5
CAS 2920407-92-5 is the registry number for H2N-PEG4-CH2CH2CONHNHBoc, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 3,3-difluoro-5-(hydroxymethyl)-5-methylpiperidine-1-carboxylate (CAS 2920407-92-5) is a chemical compound with the molecular formula C12H21F2NO3 and a molecular weight of 265.30 g/mol. IUPAC name: tert-butyl 3,3-difluoro-5-(hydroxymethyl)-5-methylpiperidine-1-carboxylate. InChIKey: HMCZPJMLAUXIOH-UHFFFAOYSA-N.
| Molecular formula | C12H21F2NO3 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-5-(hydroxymethyl)-5-methylpiperidine-1-carboxylate |
| InChIKey | HMCZPJMLAUXIOH-UHFFFAOYSA-N |
| SMILES | CC1(CC(CN(C1)C(=O)OC(C)(C)C)(F)F)CO |
Computed by PubChem (NCBI)