Products 1934529-35-7
CAS 1934529-35-7 is the registry number for (1-Azabicyclo[3.2.1]octan-5-yl)methanesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-azabicyclo[3.2.1]octan-5-ylmethanesulfonyl chloride (CAS 1934529-35-7) is a chemical compound with the molecular formula C8H14ClNO2S and a molecular weight of 223.72 g/mol. IUPAC name: 1-azabicyclo[3.2.1]octan-5-ylmethanesulfonyl chloride. InChIKey: VDPOXWUJQKGGLJ-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO2S |
|---|---|
| Molecular weight | 223.72 g/mol |
| IUPAC name | 1-azabicyclo[3.2.1]octan-5-ylmethanesulfonyl chloride |
| InChIKey | VDPOXWUJQKGGLJ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCN(C1)C2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)