CAS 2202731-24-4 is the registry number for Rel-(3aR,3bS,6aR,6bS)-octahydro-1H-thieno[3',4':3,4]Cyclobuta[1,2-c]pyrrole 2,2-Dioxide hydroChloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2R,6S,7R)-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane 4,4-dioxide;hydrochloride (CAS 2202731-24-4) is a chemical compound with the molecular formula C8H14ClNO2S and a molecular weight of 223.72 g/mol. IUPAC name: (1S,2R,6S,7R)-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane 4,4-dioxide;hydrochloride. InChIKey: DSFLMHFGBRHQLO-WTSYXZODSA-N.
| Molecular formula | C8H14ClNO2S |
|---|---|
| Molecular weight | 223.72 g/mol |
| IUPAC name | (1S,2R,6S,7R)-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane 4,4-dioxide;hydrochloride |
| InChIKey | DSFLMHFGBRHQLO-WTSYXZODSA-N |
| SMILES | C1[C@@H]2[C@H](CN1)[C@@H]3[C@H]2CS(=O)(=O)C3.Cl |
Computed by PubChem (NCBI)