Products 2059915-51-2
CAS 2059915-51-2 is the registry number for (3aR,​3bS,​6aR,​6bS)​-Octahydro-1H-​thieno(3',​4':3,​4)​cyclobuta(1,​2-​c)​pyrrole 2,​2-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,2R,6S,7R)-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane 4,4-dioxide;hydrochloride (CAS 2059915-51-2) is a chemical compound with the molecular formula C8H14ClNO2S and a molecular weight of 223.72 g/mol. IUPAC name: (1S,2R,6S,7R)-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane 4,4-dioxide;hydrochloride. InChIKey: DSFLMHFGBRHQLO-WTSYXZODSA-N.
| Molecular formula | C8H14ClNO2S |
|---|---|
| Molecular weight | 223.72 g/mol |
| IUPAC name | (1S,2R,6S,7R)-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane 4,4-dioxide;hydrochloride |
| InChIKey | DSFLMHFGBRHQLO-WTSYXZODSA-N |
| SMILES | C1[C@@H]2[C@H](CN1)[C@@H]3[C@H]2CS(=O)(=O)C3.Cl |
Computed by PubChem (NCBI)