CAS 1934574-19-2 is the registry number for 4-Bromo-6-chloro-1-methyl-1H-indazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-bromo-6-chloro-1-methylindazole (CAS 1934574-19-2) is a chemical compound with the molecular formula C8H6BrClN2 and a molecular weight of 245.50 g/mol. IUPAC name: 4-bromo-6-chloro-1-methylindazole. InChIKey: RJSSDDIREIPBGR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2 |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 4-bromo-6-chloro-1-methylindazole |
| InChIKey | RJSSDDIREIPBGR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)