CAS 1934691-63-0 is the registry number for tert-Butyl N-(4-iodo-3-methoxyphenyl)carbamate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Tert-butyl N-(4-iodo-3-methoxyphenyl)carbamate (CAS 1934691-63-0) is a chemical compound with the molecular formula C12H16INO3 and a molecular weight of 349.16 g/mol. IUPAC name: tert-butyl N-(4-iodo-3-methoxyphenyl)carbamate. InChIKey: VNINTXNLAZTBDV-UHFFFAOYSA-N.
| Molecular formula | C12H16INO3 |
|---|---|
| Molecular weight | 349.16 g/mol |
| IUPAC name | tert-butyl N-(4-iodo-3-methoxyphenyl)carbamate |
| InChIKey | VNINTXNLAZTBDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)I)OC |
Computed by PubChem (NCBI)