Products 876346-94-0

CAS 876346-94-0 is the registry number for tert-Butyl N-(4-iodo-2-methoxyphenyl)carbamate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4-iodo-2-methoxyphenyl)carbamate (CAS 876346-94-0) is a chemical compound with the molecular formula C12H16INO3 and a molecular weight of 349.16 g/mol. IUPAC name: tert-butyl N-(4-iodo-2-methoxyphenyl)carbamate. InChIKey: UEMZDSPHGUAIEF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16INO3
Molecular weight349.16 g/mol
IUPAC nametert-butyl N-(4-iodo-2-methoxyphenyl)carbamate
InChIKeyUEMZDSPHGUAIEF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=C(C=C1)I)OC

Computed by PubChem (NCBI)