Products 2168293-37-4

CAS 2168293-37-4 is the registry number for [2-(2-Iodo-ethoxy)-ethyl]-carbamic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[2-(2-iodoethoxy)ethyl]carbamate (CAS 2168293-37-4) is a chemical compound with the molecular formula C12H16INO3 and a molecular weight of 349.16 g/mol. IUPAC name: benzyl N-[2-(2-iodoethoxy)ethyl]carbamate. InChIKey: RFQSAXAQIRVFPC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16INO3
Molecular weight349.16 g/mol
IUPAC namebenzyl N-[2-(2-iodoethoxy)ethyl]carbamate
InChIKeyRFQSAXAQIRVFPC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCOCCI

Computed by PubChem (NCBI)