Products 1934736-49-8

CAS 1934736-49-8 is the registry number for 5-Bromo-2,6-dimethylnicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-2,6-dimethylpyridine-3-carboxylic acid (CAS 1934736-49-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 5-bromo-2,6-dimethylpyridine-3-carboxylic acid. InChIKey: HCKJIZJPVNYXEF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO2
Molecular weight230.06 g/mol
IUPAC name5-bromo-2,6-dimethylpyridine-3-carboxylic acid
InChIKeyHCKJIZJPVNYXEF-UHFFFAOYSA-N
SMILESCC1=C(C=C(C(=N1)C)C(=O)O)Br

Computed by PubChem (NCBI)