CAS 1934789-60-2 appears in our catalog under these names: 1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-3-fluoroazetidine-3-carboxylic acid, 95%, 1-{((9H-Fluoren-9-yl)methoxy)carbonyl}-3-fluoroazetidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(9H-fluoren-9-ylmethoxycarbonyl)-3-fluoroazetidine-3-carboxylic acid (CAS 1934789-60-2) is a chemical compound with the molecular formula C19H16FNO4 and a molecular weight of 341.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-fluoroazetidine-3-carboxylic acid. InChIKey: IJTNKSBPPIQONE-UHFFFAOYSA-N.
| Molecular formula | C19H16FNO4 |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-fluoroazetidine-3-carboxylic acid |
| InChIKey | IJTNKSBPPIQONE-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(C(=O)O)F |
Computed by PubChem (NCBI)