Products 2136579-33-2

CAS 2136579-33-2 is the registry number for AKR1B10-IN-1, 95.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 100 mg, 5 mg, 10mM/1mL, 25 mg.

Structural formula: {0} (CAS {1})

N-[3-(4-fluorophenyl)propyl]-7-hydroxy-2-oxochromene-3-carboxamide (CAS 2136579-33-2) is a chemical compound with the molecular formula C19H16FNO4 and a molecular weight of 341.3 g/mol. IUPAC name: N-[3-(4-fluorophenyl)propyl]-7-hydroxy-2-oxochromene-3-carboxamide. InChIKey: YNGXWVIJSUJZSG-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16FNO4
Molecular weight341.3 g/mol
IUPAC nameN-[3-(4-fluorophenyl)propyl]-7-hydroxy-2-oxochromene-3-carboxamide
InChIKeyYNGXWVIJSUJZSG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCCNC(=O)C2=CC3=C(C=C(C=C3)O)OC2=O)F

Computed by PubChem (NCBI)