CAS 3059671-44-9 is the registry number for AKR1C3-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[(7-fluoro-2H-chromene-3-carbonyl)-methylamino]methyl]benzoic acid (CAS 3059671-44-9) is a chemical compound with the molecular formula C19H16FNO4 and a molecular weight of 341.3 g/mol. IUPAC name: 4-[[(7-fluoro-2H-chromene-3-carbonyl)-methylamino]methyl]benzoic acid. InChIKey: OQIUBBLCWUHZFT-UHFFFAOYSA-N.
| Molecular formula | C19H16FNO4 |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | 4-[[(7-fluoro-2H-chromene-3-carbonyl)-methylamino]methyl]benzoic acid |
| InChIKey | OQIUBBLCWUHZFT-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)C(=O)O)C(=O)C2=CC3=C(C=C(C=C3)F)OC2 |
Computed by PubChem (NCBI)