Products 3059671-44-9

CAS 3059671-44-9 is the registry number for AKR1C3-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-[[(7-fluoro-2H-chromene-3-carbonyl)-methylamino]methyl]benzoic acid (CAS 3059671-44-9) is a chemical compound with the molecular formula C19H16FNO4 and a molecular weight of 341.3 g/mol. IUPAC name: 4-[[(7-fluoro-2H-chromene-3-carbonyl)-methylamino]methyl]benzoic acid. InChIKey: OQIUBBLCWUHZFT-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16FNO4
Molecular weight341.3 g/mol
IUPAC name4-[[(7-fluoro-2H-chromene-3-carbonyl)-methylamino]methyl]benzoic acid
InChIKeyOQIUBBLCWUHZFT-UHFFFAOYSA-N
SMILESCN(CC1=CC=C(C=C1)C(=O)O)C(=O)C2=CC3=C(C=C(C=C3)F)OC2

Computed by PubChem (NCBI)

Synonyms: orb3028031