CAS 19348-53-9 appears in our catalog under these names: 2-(4-Amino-2-chlorophenyl)-1h-isoindole-1,3(2h)-dione, 95%, 2-(4-Amino-2-chlorophenyl)isoindoline-1,3-dione 97%, 2-(4-AMINO-2-CHLOROPHENYL)-1H-ISOINDOLE-1,3(2H)-DIONE, 97%, 97%, 2-(4-Amino-2-chlorophenyl)-2,3-dihydro-1h-isoindole-1,3-dione, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-(4-amino-2-chlorophenyl)isoindole-1,3-dione (CAS 19348-53-9) is a chemical compound with the molecular formula C14H9ClN2O2 and a molecular weight of 272.68 g/mol. IUPAC name: 2-(4-amino-2-chlorophenyl)isoindole-1,3-dione. InChIKey: DRZDMSPFGPTPER-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O2 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 2-(4-amino-2-chlorophenyl)isoindole-1,3-dione |
| InChIKey | DRZDMSPFGPTPER-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=C(C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)