CAS 54841-24-6 is the registry number for 1,4-Diamino-2-chloroanthracene-9,10-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,4-diamino-2-chloroanthracene-9,10-dione (CAS 54841-24-6) is a chemical compound with the molecular formula C14H9ClN2O2 and a molecular weight of 272.68 g/mol. IUPAC name: 1,4-diamino-2-chloroanthracene-9,10-dione. InChIKey: NNXSVNHFDAUPRN-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O2 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 1,4-diamino-2-chloroanthracene-9,10-dione |
| InChIKey | NNXSVNHFDAUPRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3N)Cl)N |
Computed by PubChem (NCBI)