Products 900015-65-8

CAS 900015-65-8 is the registry number for 2-(6-Chloroimidazo[1,2-a]pyridin-2-yl)benzenecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid (CAS 900015-65-8) is a chemical compound with the molecular formula C14H9ClN2O2 and a molecular weight of 272.68 g/mol. IUPAC name: 2-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid. InChIKey: BJVHZIZUAFJVJV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9ClN2O2
Molecular weight272.68 g/mol
IUPAC name2-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzoic acid
InChIKeyBJVHZIZUAFJVJV-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CN3C=C(C=CC3=N2)Cl)C(=O)O

Computed by PubChem (NCBI)