Products 1934982-87-2
CAS 1934982-87-2 is the registry number for 1,5,7-Trimethylbicyclo(3.3.1)nonan-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,5,7-trimethylbicyclo[3.3.1]nonan-3-one (CAS 1934982-87-2) is a chemical compound with the molecular formula C12H20O and a molecular weight of 180.29 g/mol. IUPAC name: 1,5,7-trimethylbicyclo[3.3.1]nonan-3-one. InChIKey: ZFZWQPRCPYAFHS-UHFFFAOYSA-N.
| Molecular formula | C12H20O |
|---|---|
| Molecular weight | 180.29 g/mol |
| IUPAC name | 1,5,7-trimethylbicyclo[3.3.1]nonan-3-one |
| InChIKey | ZFZWQPRCPYAFHS-UHFFFAOYSA-N |
| SMILES | CC1CC2(CC(=O)CC(C1)(C2)C)C |
Computed by PubChem (NCBI)