CAS 19350-76-6 is the registry number for Benzenesulfonic acid, 4-methyl-2-(3-pyridinylmethylene)hydrazide. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
4-methyl-N-[(E)-pyridin-3-ylmethylideneamino]benzenesulfonamide (CAS 19350-76-6) is a chemical compound with the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. IUPAC name: 4-methyl-N-[(E)-pyridin-3-ylmethylideneamino]benzenesulfonamide. InChIKey: PMQPVPKXDUISEM-XNTDXEJSSA-N.
| Molecular formula | C13H13N3O2S |
|---|---|
| Molecular weight | 275.33 g/mol |
| IUPAC name | 4-methyl-N-[(E)-pyridin-3-ylmethylideneamino]benzenesulfonamide |
| InChIKey | PMQPVPKXDUISEM-XNTDXEJSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CN=CC=C2 |
Computed by PubChem (NCBI)