Products 1989672-32-3
CAS 1989672-32-3 is the registry number for tert-Butyl 2-cyano-2-{(1,3)thiazolo(5,4-b)pyridin-2-yl}acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-cyano-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)acetate (CAS 1989672-32-3) is a chemical compound with the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. IUPAC name: tert-butyl 2-cyano-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)acetate. InChIKey: SQHODDAYNRBUSQ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2S |
|---|---|
| Molecular weight | 275.33 g/mol |
| IUPAC name | tert-butyl 2-cyano-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)acetate |
| InChIKey | SQHODDAYNRBUSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C#N)C1=NC2=C(S1)N=CC=C2 |
Computed by PubChem (NCBI)