CAS 331959-40-1 appears in our catalog under these names: 5-Amino-3-methyl-n2-phenylthiophene-2,4-dicarboxamide, 95%, 5-Amino-3-methyl-N2-phenylthiophene-2,4-dicarboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-amino-3-methyl-2-N-phenylthiophene-2,4-dicarboxamide (CAS 331959-40-1) is a chemical compound with the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. IUPAC name: 5-amino-3-methyl-2-N-phenylthiophene-2,4-dicarboxamide. InChIKey: HUXCUBHSRXMRRQ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2S |
|---|---|
| Molecular weight | 275.33 g/mol |
| IUPAC name | 5-amino-3-methyl-2-N-phenylthiophene-2,4-dicarboxamide |
| InChIKey | HUXCUBHSRXMRRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)N)N)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)