Products 1935322-93-2
CAS 1935322-93-2 appears in our catalog under these names: 6'-Bromo-7'-fluorospiro[cyclopropane-1,3'-indolin]-2'-one 98%, 6'-Bromo-7'-fluorospiro[cyclopropane-1,3'-indolin]-2'-one, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 50mg, 250mg, 1g, 100mg.
6-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 1935322-93-2) is a chemical compound with the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. IUPAC name: 6-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: JUMSBROOONOKFT-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFNO |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 6-bromo-7-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | JUMSBROOONOKFT-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C(=C(C=C3)Br)F)NC2=O |
Computed by PubChem (NCBI)