Products 1935445-81-0
CAS 1935445-81-0 appears in our catalog under these names: Ethyl 3-chloro-5,6-dimethylpyridazine-4-carboxylate, 98%, Ethyl 3-chloro-5,6-dimethylpyridazine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
Ethyl 3-chloro-5,6-dimethylpyridazine-4-carboxylate (CAS 1935445-81-0) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: ethyl 3-chloro-5,6-dimethylpyridazine-4-carboxylate. InChIKey: YNBMQBKCZSNDIW-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | ethyl 3-chloro-5,6-dimethylpyridazine-4-carboxylate |
| InChIKey | YNBMQBKCZSNDIW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=NC(=C1C)C)Cl |
Computed by PubChem (NCBI)