CAS 19359-40-1 appears in our catalog under these names: 2,2-Dichloro-N-(4-chlorophenyl)-3-oxo-3-phenylpropanamide, 95%, 2,2-Dichloro-N-(4-chlorophenyl)-3-oxo-3-phenylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2,2-dichloro-N-(4-chlorophenyl)-3-oxo-3-phenylpropanamide (CAS 19359-40-1) is a chemical compound with the molecular formula C15H10Cl3NO2 and a molecular weight of 342.6 g/mol. IUPAC name: 2,2-dichloro-N-(4-chlorophenyl)-3-oxo-3-phenylpropanamide. InChIKey: NYVXFUCPSANXPE-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl3NO2 |
|---|---|
| Molecular weight | 342.6 g/mol |
| IUPAC name | 2,2-dichloro-N-(4-chlorophenyl)-3-oxo-3-phenylpropanamide |
| InChIKey | NYVXFUCPSANXPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(=O)NC2=CC=C(C=C2)Cl)(Cl)Cl |
Computed by PubChem (NCBI)