CAS 1936045-51-0 appears in our catalog under these names: ((4-Hydroxyphenyl)imino)dimethyl-lambda6-sulfanone, 98%, 4-​((Dimethyloxido-​λ4-​sulfanylidene)​amino)​-phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 0,5g, 50mg.
4-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]phenol (CAS 1936045-51-0) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 4-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]phenol. InChIKey: NZHKRALTGNTRBA-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 4-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]phenol |
| InChIKey | NZHKRALTGNTRBA-UHFFFAOYSA-N |
| SMILES | CS(=NC1=CC=C(C=C1)O)(=O)C |
Computed by PubChem (NCBI)