CAS 1936054-58-8 is the registry number for 2-Bromo-4-fluoro-6-iodobenzyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2-bromo-4-fluoro-6-iodophenyl)methyl acetate (CAS 1936054-58-8) is a chemical compound with the molecular formula C9H7BrFIO2 and a molecular weight of 372.96 g/mol. IUPAC name: (2-bromo-4-fluoro-6-iodophenyl)methyl acetate. InChIKey: KXFMEVYIWCXQQL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFIO2 |
|---|---|
| Molecular weight | 372.96 g/mol |
| IUPAC name | (2-bromo-4-fluoro-6-iodophenyl)methyl acetate |
| InChIKey | KXFMEVYIWCXQQL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=C(C=C1I)F)Br |
Computed by PubChem (NCBI)