Products 1936054-58-8

CAS 1936054-58-8 is the registry number for 2-Bromo-4-fluoro-6-iodobenzyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2-bromo-4-fluoro-6-iodophenyl)methyl acetate (CAS 1936054-58-8) is a chemical compound with the molecular formula C9H7BrFIO2 and a molecular weight of 372.96 g/mol. IUPAC name: (2-bromo-4-fluoro-6-iodophenyl)methyl acetate. InChIKey: KXFMEVYIWCXQQL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrFIO2
Molecular weight372.96 g/mol
IUPAC name(2-bromo-4-fluoro-6-iodophenyl)methyl acetate
InChIKeyKXFMEVYIWCXQQL-UHFFFAOYSA-N
SMILESCC(=O)OCC1=C(C=C(C=C1I)F)Br

Computed by PubChem (NCBI)