Products 2385174-26-3
CAS 2385174-26-3 is the registry number for Methyl 3-(bromomethyl)-2-fluoro-4-iodobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(bromomethyl)-2-fluoro-4-iodobenzoate (CAS 2385174-26-3) is a chemical compound with the molecular formula C9H7BrFIO2 and a molecular weight of 372.96 g/mol. IUPAC name: methyl 3-(bromomethyl)-2-fluoro-4-iodobenzoate. InChIKey: KBPDTXROBKHHNW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFIO2 |
|---|---|
| Molecular weight | 372.96 g/mol |
| IUPAC name | methyl 3-(bromomethyl)-2-fluoro-4-iodobenzoate |
| InChIKey | KBPDTXROBKHHNW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)I)CBr)F |
Computed by PubChem (NCBI)