Products 2764729-58-8
CAS 2764729-58-8 is the registry number for 2-(6-Bromo-2-fluoro-3-iodophenyl)-1,3-dioxolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(6-bromo-2-fluoro-3-iodophenyl)-1,3-dioxolane (CAS 2764729-58-8) is a chemical compound with the molecular formula C9H7BrFIO2 and a molecular weight of 372.96 g/mol. IUPAC name: 2-(6-bromo-2-fluoro-3-iodophenyl)-1,3-dioxolane. InChIKey: ZVXZWFAQVOTTBK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFIO2 |
|---|---|
| Molecular weight | 372.96 g/mol |
| IUPAC name | 2-(6-bromo-2-fluoro-3-iodophenyl)-1,3-dioxolane |
| InChIKey | ZVXZWFAQVOTTBK-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2F)I)Br |
Computed by PubChem (NCBI)