CAS 1936209-21-0 is the registry number for Benzyl 2-oxo-1,6-diazaspiro[3.5]nonane-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 2-oxo-1,8-diazaspiro[3.5]nonane-8-carboxylate (CAS 1936209-21-0) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: benzyl 2-oxo-1,8-diazaspiro[3.5]nonane-8-carboxylate. InChIKey: CDDJXRKFMCUBJM-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | benzyl 2-oxo-1,8-diazaspiro[3.5]nonane-8-carboxylate |
| InChIKey | CDDJXRKFMCUBJM-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(=O)N2)CN(C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)