Products 1936215-64-3
CAS 1936215-64-3 is the registry number for 7-Bromo-3-methoxy-1-methyl-1H-indazole, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
7-bromo-3-methoxy-1-methylindazole (CAS 1936215-64-3) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-3-methoxy-1-methylindazole. InChIKey: GMXBXFSHSBTVJP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-3-methoxy-1-methylindazole |
| InChIKey | GMXBXFSHSBTVJP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2Br)C(=N1)OC |
Computed by PubChem (NCBI)