Products 1936547-14-6
CAS 1936547-14-6 is the registry number for 4-bromo-6-chlorobenzo[b]thiophene-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-6-chloro-1-benzothiophene-2-carboxylic acid (CAS 1936547-14-6) is a chemical compound with the molecular formula C9H4BrClO2S and a molecular weight of 291.55 g/mol. IUPAC name: 4-bromo-6-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: UZEKUHBYKMEGON-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClO2S |
|---|---|
| Molecular weight | 291.55 g/mol |
| IUPAC name | 4-bromo-6-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | UZEKUHBYKMEGON-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=C2)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)