Products 826995-58-8

CAS 826995-58-8 is the registry number for 6-Bromo-4-chlorobenzo[b]thiophene-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-bromo-4-chloro-1-benzothiophene-2-carboxylic acid (CAS 826995-58-8) is a chemical compound with the molecular formula C9H4BrClO2S and a molecular weight of 291.55 g/mol. IUPAC name: 6-bromo-4-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: SSCDZZXTQACMKN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4BrClO2S
Molecular weight291.55 g/mol
IUPAC name6-bromo-4-chloro-1-benzothiophene-2-carboxylic acid
InChIKeySSCDZZXTQACMKN-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1SC(=C2)C(=O)O)Cl)Br

Computed by PubChem (NCBI)