Products 1936700-15-0
CAS 1936700-15-0 is the registry number for 5-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-2(3H)-one, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-(trifluoromethyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1936700-15-0) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: BDVLQVFKFIAROJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | BDVLQVFKFIAROJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(NC1=O)N=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)