CAS 193686-70-3 appears in our catalog under these names: 2-Nitro-1H-indole, 97%, 2-Nitro-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 50mg.
2-nitro-1H-indole (CAS 193686-70-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-nitro-1H-indole. InChIKey: HCGYMSSYSAKGPK-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-nitro-1H-indole |
| InChIKey | HCGYMSSYSAKGPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)