Products 193696-42-3
CAS 193696-42-3 is the registry number for Kurasoin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-3-hydroxy-4-(1H-indol-3-yl)-1-phenylbutan-2-one (CAS 193696-42-3) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: (3R)-3-hydroxy-4-(1H-indol-3-yl)-1-phenylbutan-2-one. InChIKey: OLNJBNLERUYZTA-GOSISDBHSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | (3R)-3-hydroxy-4-(1H-indol-3-yl)-1-phenylbutan-2-one |
| InChIKey | OLNJBNLERUYZTA-GOSISDBHSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)[C@@H](CC2=CNC3=CC=CC=C32)O |
Computed by PubChem (NCBI)