CAS 1937230-53-9 is the registry number for (E)-3,5-Dibromo-N'-hydroxybenzene-1-carboximidamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,5-dibromo-N'-hydroxybenzenecarboximidamide (CAS 1937230-53-9) is a chemical compound with the molecular formula C7H6Br2N2O and a molecular weight of 293.94 g/mol. IUPAC name: 3,5-dibromo-N'-hydroxybenzenecarboximidamide. InChIKey: RODPODHLUZMCNX-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 3,5-dibromo-N'-hydroxybenzenecarboximidamide |
| InChIKey | RODPODHLUZMCNX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)/C(=N/O)/N |
Computed by PubChem (NCBI)